CAS 1218791-43-5 is the registry number for 2-t-Butylaminopyrimidine-5-boronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1218791-43-5) is a chemical compound with the molecular formula C14H24BN3O2 and a molecular weight of 277.17 g/mol. IUPAC name: N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: QSQNGIXCPKOTOQ-UHFFFAOYSA-N.
| Molecular formula | C14H24BN3O2 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | N-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | QSQNGIXCPKOTOQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NC(C)(C)C |
Computed by PubChem (NCBI)