CAS 1015242-06-4 is the registry number for 2-(Isobutylamino)pyrimidine-5-boronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (CAS 1015242-06-4) is a chemical compound with the molecular formula C14H24BN3O2 and a molecular weight of 277.17 g/mol. IUPAC name: N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine. InChIKey: FRDQITDPXLPZLZ-UHFFFAOYSA-N.
| Molecular formula | C14H24BN3O2 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | N-(2-methylpropyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| InChIKey | FRDQITDPXLPZLZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NCC(C)C |
Computed by PubChem (NCBI)