CAS 1210047-61-2 appears in our catalog under these names: 6-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline, 95%, 6-Methyl-7-(tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline (CAS 1210047-61-2) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 6-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline. InChIKey: AIQHIERPJVIJNJ-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 6-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
| InChIKey | AIQHIERPJVIJNJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NC=CN=C3C=C2C |
Computed by PubChem (NCBI)