cas: 81227-99-8 — see every product listed under this CAS number, including other names
1-[4-(Benzyloxy)-3-fluorophenyl]-1-ethanone, ≥97%, ≥97% (CAS 81227-99-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1165VP-250mg |
| cas | 81227-99-8 |
| size | 250mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 1g | 2138.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
1-(3-fluoro-4-phenylmethoxyphenyl)ethanone (CAS 81227-99-8) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. IUPAC name: 1-(3-fluoro-4-phenylmethoxyphenyl)ethanone. InChIKey: YLVZBSLWHNSLNP-UHFFFAOYSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 1-(3-fluoro-4-phenylmethoxyphenyl)ethanone |
| InChIKey | YLVZBSLWHNSLNP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)