CAS 81227-99-8 appears in our catalog under these names: 1-[4-(Benzyloxy)-3-fluorophenyl]-1-ethanone, 95%, 1-[4-(Benzyloxy)-3-fluorophenyl]-1-ethanone, ≥97%, ≥97%, 1-(4-(Benzyloxy)-3-fluorophenyl)ethan-1-one. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-(3-fluoro-4-phenylmethoxyphenyl)ethanone (CAS 81227-99-8) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. IUPAC name: 1-(3-fluoro-4-phenylmethoxyphenyl)ethanone. InChIKey: YLVZBSLWHNSLNP-UHFFFAOYSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 1-(3-fluoro-4-phenylmethoxyphenyl)ethanone |
| InChIKey | YLVZBSLWHNSLNP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)