CAS 153529-18-1 appears in our catalog under these names: 2-(3-Fluorophenyl)-1-(4-methoxyphenyl)ethanone, 95%, 2–(3–Fluorophenyl)–4–methoxyacetophenone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-(3-fluorophenyl)-1-(4-methoxyphenyl)ethanone (CAS 153529-18-1) is a chemical compound with the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. IUPAC name: 2-(3-fluorophenyl)-1-(4-methoxyphenyl)ethanone. InChIKey: PGKAVRBAZXUZIY-UHFFFAOYSA-N.
| Molecular formula | C15H13FO2 |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1-(4-methoxyphenyl)ethanone |
| InChIKey | PGKAVRBAZXUZIY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)