CAS 438-26-6 appears in our catalog under these names: 1-Amino-4-fluoronaphthalene hydrochloride, 95%, 1-Amino-4-fluoronaphthalene Hydrochloride, ≥95%, ≥95%, 1-AMINO-4-FLUORONAPHTHALENE HCL, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
4-fluoronaphthalen-1-amine;hydrochloride (CAS 438-26-6) is a chemical compound with the molecular formula C10H9ClFN and a molecular weight of 197.63 g/mol. IUPAC name: 4-fluoronaphthalen-1-amine;hydrochloride. InChIKey: YSSIEPCKKCDGMG-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFN |
|---|---|
| Molecular weight | 197.63 g/mol |
| IUPAC name | 4-fluoronaphthalen-1-amine;hydrochloride |
| InChIKey | YSSIEPCKKCDGMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)N.Cl |
Computed by PubChem (NCBI)