Products 2027452-83-9
CAS 2027452-83-9 is the registry number for 4-(3-Chloro-4-fluorophenyl)but-3-yn-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-chloro-4-fluorophenyl)but-3-yn-2-amine (CAS 2027452-83-9) is a chemical compound with the molecular formula C10H9ClFN and a molecular weight of 197.63 g/mol. IUPAC name: 4-(3-chloro-4-fluorophenyl)but-3-yn-2-amine. InChIKey: KAOWJYCOLVFJCD-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFN |
|---|---|
| Molecular weight | 197.63 g/mol |
| IUPAC name | 4-(3-chloro-4-fluorophenyl)but-3-yn-2-amine |
| InChIKey | KAOWJYCOLVFJCD-UHFFFAOYSA-N |
| SMILES | CC(C#CC1=CC(=C(C=C1)F)Cl)N |
Computed by PubChem (NCBI)