Products 1256918-64-5
CAS 1256918-64-5 is the registry number for 2-(2-chloro-3-fluorophenyl)-2-methylpropanenitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(2-chloro-3-fluorophenyl)-2-methylpropanenitrile (CAS 1256918-64-5) is a chemical compound with the molecular formula C10H9ClFN and a molecular weight of 197.63 g/mol. IUPAC name: 2-(2-chloro-3-fluorophenyl)-2-methylpropanenitrile. InChIKey: CGKXVXNPFDTVRU-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFN |
|---|---|
| Molecular weight | 197.63 g/mol |
| IUPAC name | 2-(2-chloro-3-fluorophenyl)-2-methylpropanenitrile |
| InChIKey | CGKXVXNPFDTVRU-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=C(C(=CC=C1)F)Cl |
Computed by PubChem (NCBI)