cas: 2834-92-6 — see every product listed under this CAS number, including other names
1-Aminonaphthalen-2-ol, 95%, 95% (CAS 2834-92-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I6BH-250mg |
| cas | 2834-92-6 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 630.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-aminonaphthalen-2-ol (CAS 2834-92-6) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 1-aminonaphthalen-2-ol. InChIKey: FHMMQQXRSYSWCM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 1-aminonaphthalen-2-ol |
| InChIKey | FHMMQQXRSYSWCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N)O |
Computed by PubChem (NCBI)