Products 15463-09-9

CAS 15463-09-9 is the registry number for 4-Methylquinolin-7-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-methylquinolin-7-ol (CAS 15463-09-9) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 4-methylquinolin-7-ol. InChIKey: GXFFWHIKMRPHIV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO
Molecular weight159.18 g/mol
IUPAC name4-methylquinolin-7-ol
InChIKeyGXFFWHIKMRPHIV-UHFFFAOYSA-N
SMILESCC1=C2C=CC(=CC2=NC=C1)O

Computed by PubChem (NCBI)