CAS 20984-33-2 appears in our catalog under these names: 6-Methylquinolin-8-ol, 95%, 6-Methylquinolin-8-ol 98%, 6-Methylquinolin-8-ol, 98%, 98%, 6-Methylquinolin-8-ol, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-methylquinolin-8-ol (CAS 20984-33-2) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 6-methylquinolin-8-ol. InChIKey: AIBOXZCUYYHFTM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 6-methylquinolin-8-ol |
| InChIKey | AIBOXZCUYYHFTM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)N=CC=C2 |
Computed by PubChem (NCBI)