cas: 199003-22-0 — see every product listed under this CAS number, including other names
1-BOC-4-(HYDROXYMETHYL)PYRAZOLE, 96% (CAS 199003-22-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387302-100MG |
| cas | 199003-22-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1112.13 Pln | |
| Fluorochem | 10g | 2163.84 Pln | |
| Fluorochem | 25g | 3736.20 Pln | |
| Fluorochem | 50g | 7422.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(hydroxymethyl)pyrazole-1-carboxylate (CAS 199003-22-0) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 4-(hydroxymethyl)pyrazole-1-carboxylate. InChIKey: CIPRBVVWJSJWBE-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 4-(hydroxymethyl)pyrazole-1-carboxylate |
| InChIKey | CIPRBVVWJSJWBE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=N1)CO |
Computed by PubChem (NCBI)