cas: 3611-11-8 — see every product listed under this CAS number, including other names
1-BROMO-2,6-NAPHTHYRIDIN-3-AMINE, 95%, 95% (CAS 3611-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A1Z8-100mg |
| cas | 3611-11-8 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1504.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2,6-naphthyridin-3-amine (CAS 3611-11-8) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 1-bromo-2,6-naphthyridin-3-amine. InChIKey: XCIQIUBGAYVLLE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 1-bromo-2,6-naphthyridin-3-amine |
| InChIKey | XCIQIUBGAYVLLE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC(=NC(=C21)Br)N |
Computed by PubChem (NCBI)