CAS 3611-11-8 appears in our catalog under these names: 1-Bromo-2,6-naphthyridin-3-amine, 95%, 1-BROMO-2,6-NAPHTHYRIDIN-3-AMINE, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
1-bromo-2,6-naphthyridin-3-amine (CAS 3611-11-8) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 1-bromo-2,6-naphthyridin-3-amine. InChIKey: XCIQIUBGAYVLLE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 1-bromo-2,6-naphthyridin-3-amine |
| InChIKey | XCIQIUBGAYVLLE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC(=NC(=C21)Br)N |
Computed by PubChem (NCBI)