CAS 155629-94-0 appears in our catalog under these names: 7-Bromo-2-methylpyrido[2,3-b]pyrazine, 95%, 7–Bromo–2–Methylpyrido(2,3–B)Pyrazine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100mg.
7-bromo-2-methylpyrido[2,3-b]pyrazine (CAS 155629-94-0) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 7-bromo-2-methylpyrido[2,3-b]pyrazine. InChIKey: VUTYRYIQTGJKBH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 7-bromo-2-methylpyrido[2,3-b]pyrazine |
| InChIKey | VUTYRYIQTGJKBH-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=N1)C=C(C=N2)Br |
Computed by PubChem (NCBI)