cas: 159556-72-6 — see every product listed under this CAS number, including other names
1-Benzhydryl-2,2-dimethylazetidin-3-one 95% (CAS 159556-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A260006-100mg |
| cas | 159556-72-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 937.75 Pln | |
| Ambeed | 250mg | 1549.62 Pln | |
| Ambeed | 1g | 3390.81 Pln | |
| Ambeed | 5g | 10110.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A260006 |
1-benzhydryl-2,2-dimethylazetidin-3-one (CAS 159556-72-6) is a chemical compound with the molecular formula C18H19NO and a molecular weight of 265.3 g/mol. IUPAC name: 1-benzhydryl-2,2-dimethylazetidin-3-one. InChIKey: HKKKHPBFJDQJQM-UHFFFAOYSA-N.
| Molecular formula | C18H19NO |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | 1-benzhydryl-2,2-dimethylazetidin-3-one |
| InChIKey | HKKKHPBFJDQJQM-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)CN1C(C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)