CAS 19132-98-0 appears in our catalog under these names: 4-Dimethylamino-4'-methylchalcone, 95%, 4-Dimethylamino-4'-methylchalcone, 4-Dimethylamino-4'-methylchalcone, min. 95 %, 250 mg, 4-Dimethylamino-4'-methylchalcone, min. 95 %, 500 mg, 4-Dimethylamino-4'-methylchalcone, min. 95 %, 1 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg, 5000mg, 2g, 5g.
3-[4-(dimethylamino)phenyl]-1-(4-methylphenyl)prop-2-en-1-one (CAS 19132-98-0) is a chemical compound with the molecular formula C18H19NO and a molecular weight of 265.3 g/mol. IUPAC name: 3-[4-(dimethylamino)phenyl]-1-(4-methylphenyl)prop-2-en-1-one. InChIKey: WDFJWHWYPOZAQG-UHFFFAOYSA-N.
| Molecular formula | C18H19NO |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | 3-[4-(dimethylamino)phenyl]-1-(4-methylphenyl)prop-2-en-1-one |
| InChIKey | WDFJWHWYPOZAQG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C=CC2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)