cas: 159556-72-6 — see every product listed under this CAS number, including other names
1-(Diphenylmethyl)-2,2-dimethyl-3-azetidinone, 95%, 95% (CAS 159556-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AW1J-100mg |
| cas | 159556-72-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 674.00 Pln | |
| Chemat | 250mg | 1038.80 Pln | |
| Chemat | 1g | 2502.80 Pln | |
| Chemat | 5g | 7715.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzhydryl-2,2-dimethylazetidin-3-one (CAS 159556-72-6) is a chemical compound with the molecular formula C18H19NO and a molecular weight of 265.3 g/mol. IUPAC name: 1-benzhydryl-2,2-dimethylazetidin-3-one. InChIKey: HKKKHPBFJDQJQM-UHFFFAOYSA-N.
| Molecular formula | C18H19NO |
|---|---|
| Molecular weight | 265.3 g/mol |
| IUPAC name | 1-benzhydryl-2,2-dimethylazetidin-3-one |
| InChIKey | HKKKHPBFJDQJQM-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)CN1C(C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)