cas: 17070-58-5 — see every product listed under this CAS number, including other names
1-Benzofuran-2-sulfonyl chloride, 97% (CAS 17070-58-5) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC06603CB |
| cas | 17070-58-5 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 487.19 Pln | |
| Thermo Scientific | 1g | 1379.61 Pln | |
| Thermo Scientific | 5g | 3981.01 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-benzofuran-2-sulfonyl chloride (CAS 17070-58-5) is a chemical compound with the molecular formula C8H5ClO3S and a molecular weight of 216.64 g/mol. IUPAC name: 1-benzofuran-2-sulfonyl chloride. InChIKey: RWCKBBSBRTUUHR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3S |
|---|---|
| Molecular weight | 216.64 g/mol |
| IUPAC name | 1-benzofuran-2-sulfonyl chloride |
| InChIKey | RWCKBBSBRTUUHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)