cas: 17070-58-5 — see every product listed under this CAS number, including other names
Benzofuran-2-sulfonyl chloride, 95%, 95% (CAS 17070-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQ1P-100mg |
| cas | 17070-58-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 870.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzofuran-2-sulfonyl chloride (CAS 17070-58-5) is a chemical compound with the molecular formula C8H5ClO3S and a molecular weight of 216.64 g/mol. IUPAC name: 1-benzofuran-2-sulfonyl chloride. InChIKey: RWCKBBSBRTUUHR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3S |
|---|---|
| Molecular weight | 216.64 g/mol |
| IUPAC name | 1-benzofuran-2-sulfonyl chloride |
| InChIKey | RWCKBBSBRTUUHR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)