CAS 2007916-59-6 appears in our catalog under these names: 1-Benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate hydrochloride, 95%, 1-Benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate hydrochloride, 97%, O1-benzyl O4-methyl 4-aminopiperidine-1,4-dicarboxylate,hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 25g, 500mg, 5g, 10g.
1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate;hydrochloride (CAS 2007916-59-6) is a chemical compound with the molecular formula C15H21ClN2O4 and a molecular weight of 328.79 g/mol. IUPAC name: 1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate;hydrochloride. InChIKey: KXKYWBBWTMDWNT-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O4 |
|---|---|
| Molecular weight | 328.79 g/mol |
| IUPAC name | 1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate;hydrochloride |
| InChIKey | KXKYWBBWTMDWNT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCN(CC1)C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)