Products 2177257-75-7

CAS 2177257-75-7 is the registry number for 1-Benzyl 2-ethyl piperazine-1,2-dicarboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-benzyl 2-O-ethyl piperazine-1,2-dicarboxylate;hydrochloride (CAS 2177257-75-7) is a chemical compound with the molecular formula C15H21ClN2O4 and a molecular weight of 328.79 g/mol. IUPAC name: 1-O-benzyl 2-O-ethyl piperazine-1,2-dicarboxylate;hydrochloride. InChIKey: IDCOXVBMUFVKMM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21ClN2O4
Molecular weight328.79 g/mol
IUPAC name1-O-benzyl 2-O-ethyl piperazine-1,2-dicarboxylate;hydrochloride
InChIKeyIDCOXVBMUFVKMM-UHFFFAOYSA-N
SMILESCCOC(=O)C1CNCCN1C(=O)OCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)