CAS 2306253-26-7 is the registry number for O1-benzyl O2-methyl trans-5-aminopiperidine-1,2-dicarboxylate,hydrochloride, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-O-benzyl 2-O-methyl (2R,5S)-5-aminopiperidine-1,2-dicarboxylate;hydrochloride (CAS 2306253-26-7) is a chemical compound with the molecular formula C15H21ClN2O4 and a molecular weight of 328.79 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2R,5S)-5-aminopiperidine-1,2-dicarboxylate;hydrochloride. InChIKey: BXRFSXRNTVBWJR-JHEYCYPBSA-N.
| Molecular formula | C15H21ClN2O4 |
|---|---|
| Molecular weight | 328.79 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2R,5S)-5-aminopiperidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | BXRFSXRNTVBWJR-JHEYCYPBSA-N |
| SMILES | COC(=O)[C@H]1CC[C@@H](CN1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)