cas: 23450-18-2 — see every product listed under this CAS number, including other names
1-Benzyl-2-bromobenzene 99% (CAS 23450-18-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A461737-250mg |
| cas | 23450-18-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 798.69 Pln | |
| Ambeed | 25g | 2656.56 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A461737 |
1-benzyl-2-bromobenzene (CAS 23450-18-2) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-benzyl-2-bromobenzene. InChIKey: DLCYFIIONMLNAJ-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-benzyl-2-bromobenzene |
| InChIKey | DLCYFIIONMLNAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=CC=C2Br |
Computed by PubChem (NCBI)