CAS 14704-31-5 appears in our catalog under these names: Bifeprunox Impurity 1, 3-(Bromomethyl)-1,1'-biphenyl, >98.0%(GC), 3-Phenylbenzyl bromide 97%, 3-PHENYLBENZYL BROMIDE, 97%, 3-Bromomethylbiphenyl, 98%. Offered by: Chemat Brand, TCI, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: on request, 1g, 5g, 10g, 25g.
1-(bromomethyl)-3-phenylbenzene (CAS 14704-31-5) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-(bromomethyl)-3-phenylbenzene. InChIKey: RTFPTPXBTIUISM-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-(bromomethyl)-3-phenylbenzene |
| InChIKey | RTFPTPXBTIUISM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CBr |
Computed by PubChem (NCBI)