Products 2567-29-5
CAS 2567-29-5 appears in our catalog under these names: 4-(Bromomethyl)biphenyl, 4–(Bromomethyl)biphenyl, 4-(Bromomethyl)biphenyl, 96%, 4-Bromomethylbiphenyl, >98.0%(GC), 4-(Bromomethyl)-1,1'-biphenyl 98%. Offered by: TRC, GLPBio, Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 50g, 500g, 1kg.
1-(bromomethyl)-4-phenylbenzene (CAS 2567-29-5) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-(bromomethyl)-4-phenylbenzene. InChIKey: HZQLUIZFUXNFHK-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-(bromomethyl)-4-phenylbenzene |
| InChIKey | HZQLUIZFUXNFHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)