cas: 1027511-74-5 — see every product listed under this CAS number, including other names
1-Benzyl-3-(Boc-amino)pyrrolidine-3-carboxylic Acid, 97%, 97% (CAS 1027511-74-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1119AE-100mg |
| cas | 1027511-74-5 |
| size | 100mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 500mg | 525.20 Pln | |
| Chemat | 1g | 803.60 Pln | |
| Chemat | 5g | 2291.60 Pln | |
| Chemat | 10g | 3774.80 Pln | |
| Chemat | 25g | 7490.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylic acid (CAS 1027511-74-5) is a chemical compound with the molecular formula C17H24N2O4 and a molecular weight of 320.4 g/mol. IUPAC name: 1-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylic acid. InChIKey: PXFJWKWTINVBAL-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O4 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 1-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-3-carboxylic acid |
| InChIKey | PXFJWKWTINVBAL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCN(C1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)