cas: 153687-32-2 — see every product listed under this CAS number, including other names
1-Benzyl-3-methyl-1H-pyrazole-4-carbaldehyde, 97% (CAS 153687-32-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1069780-10g |
| cas | 153687-32-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 7921.06 Pln | |
| AmBeed | 5g | 4321.03 Pln | |
| AmBeed | 100mg | 434.56 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-benzyl-3-methylpyrazole-4-carbaldehyde (CAS 153687-32-2) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: 1-benzyl-3-methylpyrazole-4-carbaldehyde. InChIKey: NXRGCJKNIMOLTC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 1-benzyl-3-methylpyrazole-4-carbaldehyde |
| InChIKey | NXRGCJKNIMOLTC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)