cas: 949-69-9 — see every product listed under this CAS number, including other names
1-Benzylpiperidin-4-one oxime 97% (CAS 949-69-9) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A248768-25g |
| cas | 949-69-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 203.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A248768 |
N-(1-benzylpiperidin-4-ylidene)hydroxylamine (CAS 949-69-9) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: N-(1-benzylpiperidin-4-ylidene)hydroxylamine. InChIKey: VIMRHNNRKUWOIZ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | N-(1-benzylpiperidin-4-ylidene)hydroxylamine |
| InChIKey | VIMRHNNRKUWOIZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=NO)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)