cas: 182919-58-0 — see every product listed under this CAS number, including other names
1-Benzylpiperidine-3-carbohydrazide 95+% (CAS 182919-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A556886-100mg |
| cas | 182919-58-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 737.50 Pln | |
| Ambeed | 1g | 1844.44 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A556886 |
1-benzylpiperidine-3-carbohydrazide (CAS 182919-58-0) is a chemical compound with the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. IUPAC name: 1-benzylpiperidine-3-carbohydrazide. InChIKey: WUDDEGZXFZWRKR-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 1-benzylpiperidine-3-carbohydrazide |
| InChIKey | WUDDEGZXFZWRKR-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)