cas: 182919-58-0 — see every product listed under this CAS number, including other names
1-Benzylpiperidine-3-carbohydrazide, 95+%, 95+% (CAS 182919-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11359D-100mg |
| cas | 182919-58-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1370.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-benzylpiperidine-3-carbohydrazide (CAS 182919-58-0) is a chemical compound with the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. IUPAC name: 1-benzylpiperidine-3-carbohydrazide. InChIKey: WUDDEGZXFZWRKR-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 1-benzylpiperidine-3-carbohydrazide |
| InChIKey | WUDDEGZXFZWRKR-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)