cas: 960294-18-2 — see every product listed under this CAS number, including other names
1-Boc-1,8-diazaspiro[5.5]undecane 95% (CAS 960294-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A325179-100mg |
| cas | 960294-18-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 5g | 3440.88 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1193.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A325179 |
Tert-butyl 1,8-diazaspiro[5.5]undecane-1-carboxylate (CAS 960294-18-2) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl 1,8-diazaspiro[5.5]undecane-1-carboxylate. InChIKey: VPLODDZAJNYXTC-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl 1,8-diazaspiro[5.5]undecane-1-carboxylate |
| InChIKey | VPLODDZAJNYXTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC12CCCNC2 |
Computed by PubChem (NCBI)