cas: 86447-11-2 — see every product listed under this CAS number, including other names
1-Boc-1,2,5,6-tetrahydropyridine-3-carboxylic acid, 98%, 98% (CAS 86447-11-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115N1B-100mg |
| cas | 86447-11-2 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 789.20 Pln | |
| Chemat | 25g | 3304.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid (CAS 86447-11-2) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid. InChIKey: KKHQYUPHBPYITH-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid |
| InChIKey | KKHQYUPHBPYITH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC=C(C1)C(=O)O |
Computed by PubChem (NCBI)