Products 1352723-48-8

CAS 1352723-48-8 is the registry number for 2,2-Dimethyl-3,5-dioxo-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2,2-dimethyl-3,5-dioxopyrrolidine-1-carboxylate (CAS 1352723-48-8) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: tert-butyl 2,2-dimethyl-3,5-dioxopyrrolidine-1-carboxylate. InChIKey: WAXXNFZYMOMJPD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO4
Molecular weight227.26 g/mol
IUPAC nametert-butyl 2,2-dimethyl-3,5-dioxopyrrolidine-1-carboxylate
InChIKeyWAXXNFZYMOMJPD-UHFFFAOYSA-N
SMILESCC1(C(=O)CC(=O)N1C(=O)OC(C)(C)C)C

Computed by PubChem (NCBI)