CAS 1352723-48-8 is the registry number for 2,2-Dimethyl-3,5-dioxo-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl 2,2-dimethyl-3,5-dioxopyrrolidine-1-carboxylate (CAS 1352723-48-8) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: tert-butyl 2,2-dimethyl-3,5-dioxopyrrolidine-1-carboxylate. InChIKey: WAXXNFZYMOMJPD-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | tert-butyl 2,2-dimethyl-3,5-dioxopyrrolidine-1-carboxylate |
| InChIKey | WAXXNFZYMOMJPD-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)CC(=O)N1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)