1-Boc-2,6-dimethylpiperazine, 95% (cis)
cas: 688363-66-8 — see every product listed under this CAS number, including other names
1-Boc-2,6-dimethylpiperazine, 95% (cis) (CAS 688363-66-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A166852-250mg |
| cas | 688363-66-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2550.88 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 798.80 Pln | |
| BLDpharm | 100mg | 131.09 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 836.40 Pln | |
| BLDpharm | 25g | 2746.84 Pln |
properties
| purity | 95% (cis) |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 2,6-dimethylpiperazine-1-carboxylate (CAS 688363-66-8) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl 2,6-dimethylpiperazine-1-carboxylate. InChIKey: RBOGBIZGALIITO-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl 2,6-dimethylpiperazine-1-carboxylate |
| InChIKey | RBOGBIZGALIITO-UHFFFAOYSA-N |
| SMILES | CC1CNCC(N1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
1-Boc-2,6-dimethylpiperazine, tert-butyl 2,6-dimethylpiperazine-1-carboxylate, trans-1-Boc-2,6-dimethyl-piperazine, (2S,6S)-1-Boc-2,6-dimethyl-piperazine, RBOGBIZGALIITO-UHFFFAOYSA-N, cis-1-Boc-2,6-dimethyl-piperazine, tert-butyl-2,6-dimethylpiperazine-1-carboxylate, tert-butyl 2,6-dimethylpiperazine-1-carboxylate, cis