Products 688363-66-8

CAS 688363-66-8 appears in our catalog under these names: 1–Boc–2,6–dimethylpiperazine, 1-Boc-2,6-dimethylpiperazine 95%, 1-Boc-2,6-dimethylpiperazine, 95%, 95%, 1-Boc-2,6-dimethylpiperazine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,6-dimethylpiperazine-1-carboxylate (CAS 688363-66-8) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl 2,6-dimethylpiperazine-1-carboxylate. InChIKey: RBOGBIZGALIITO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22N2O2
Molecular weight214.30 g/mol
IUPAC nametert-butyl 2,6-dimethylpiperazine-1-carboxylate
InChIKeyRBOGBIZGALIITO-UHFFFAOYSA-N
SMILESCC1CNCC(N1C(=O)OC(C)(C)C)C

Computed by PubChem (NCBI)