cas: 255864-58-5 — see every product listed under this CAS number, including other names
1-Boc-2-Ethynylpiperidine, 97% (CAS 255864-58-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223515-1G |
| cas | 255864-58-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1299.56 Pln | |
| Fluorochem | 10g | 1762.94 Pln | |
| Fluorochem | 25g | 3470.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 2-ethynylpiperidine-1-carboxylate (CAS 255864-58-5) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: tert-butyl 2-ethynylpiperidine-1-carboxylate. InChIKey: OLYLUYXEZAJXAC-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | tert-butyl 2-ethynylpiperidine-1-carboxylate |
| InChIKey | OLYLUYXEZAJXAC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C#C |
Computed by PubChem (NCBI)