CAS 287192-99-8 appears in our catalog under these names: 1-Piperidinecarboxylic acid, 3-ethynyl-, 1,1-dimethylethyl ester, (3r)-, 95%, tert-Butyl (R)-3-ethynylpiperidine-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl (3R)-3-ethynylpiperidine-1-carboxylate (CAS 287192-99-8) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: tert-butyl (3R)-3-ethynylpiperidine-1-carboxylate. InChIKey: IJHRDEPFBAXIMW-JTQLQIEISA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | tert-butyl (3R)-3-ethynylpiperidine-1-carboxylate |
| InChIKey | IJHRDEPFBAXIMW-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)C#C |
Computed by PubChem (NCBI)