CAS 50634-31-6 is the registry number for tert-Butyl 3,4,5-trimethyl-2-pyrrolecarboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate (CAS 50634-31-6) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: tert-butyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate. InChIKey: JPUCLUDOOSRGFH-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | tert-butyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate |
| InChIKey | JPUCLUDOOSRGFH-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)