cas: 362704-66-3 — see every product listed under this CAS number, including other names
1-Boc-2-methyl-piperidin-5-one, 95%, 95% (CAS 362704-66-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CQU1-50mg |
| cas | 362704-66-3 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 194.00 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 500mg | 664.40 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 4427.60 Pln | |
| Chemat | 10g | 8416.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-methyl-5-oxopiperidine-1-carboxylate (CAS 362704-66-3) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 2-methyl-5-oxopiperidine-1-carboxylate. InChIKey: CSTUUOYWLVVNLE-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 2-methyl-5-oxopiperidine-1-carboxylate |
| InChIKey | CSTUUOYWLVVNLE-UHFFFAOYSA-N |
| SMILES | CC1CCC(=O)CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)