cas: 479080-28-9 — see every product listed under this CAS number, including other names
1-Boc-3-(N-Hydroxycarbamimidoyl)piperidine, 95%, 95% (CAS 479080-28-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DA4C-100mg |
| cas | 479080-28-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 3990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylate (CAS 479080-28-9) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylate. InChIKey: KCVBHZWEPHUWBW-UHFFFAOYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 3-[(Z)-N'-hydroxycarbamimidoyl]piperidine-1-carboxylate |
| InChIKey | KCVBHZWEPHUWBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)/C(=N/O)/N |
Computed by PubChem (NCBI)