cas: 57476-50-3 — see every product listed under this CAS number, including other names
1-Boc-3-Formylindole 98% (CAS 57476-50-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A371064-1g |
| cas | 57476-50-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 631.81 Pln | |
| Ambeed | 500g | 2033.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A371064 |
Tert-butyl 3-formylindole-1-carboxylate (CAS 57476-50-3) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: tert-butyl 3-formylindole-1-carboxylate. InChIKey: GDYHUGFAKMUUQL-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | tert-butyl 3-formylindole-1-carboxylate |
| InChIKey | GDYHUGFAKMUUQL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C=O |
Computed by PubChem (NCBI)