cas: 57476-50-3 — see every product listed under this CAS number, including other names
1-Boc-3-Formylindole, 98%, 98% (CAS 57476-50-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0R7-1g |
| cas | 57476-50-3 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 390.80 Pln | |
| Chemat | 500g | 1454.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-formylindole-1-carboxylate (CAS 57476-50-3) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: tert-butyl 3-formylindole-1-carboxylate. InChIKey: GDYHUGFAKMUUQL-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | tert-butyl 3-formylindole-1-carboxylate |
| InChIKey | GDYHUGFAKMUUQL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C=O |
Computed by PubChem (NCBI)