cas: 1000931-04-3 — see every product listed under this CAS number, including other names
1-Boc-3-Hydroxy-4-phenylpiperidine, 95%, 95% (CAS 1000931-04-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1111VP-50mg |
| cas | 1000931-04-3 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 93.20 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-hydroxy-4-phenylpiperidine-1-carboxylate (CAS 1000931-04-3) is a chemical compound with the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 3-hydroxy-4-phenylpiperidine-1-carboxylate. InChIKey: HWNKSGVMOCONJS-UHFFFAOYSA-N.
| Molecular formula | C16H23NO3 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-4-phenylpiperidine-1-carboxylate |
| InChIKey | HWNKSGVMOCONJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)