cas: 1000931-04-3 — see every product listed under this CAS number, including other names
1-Boc-3-Hydroxy-4-phenylpiperidine, 95% (CAS 1000931-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221892-100MG |
| cas | 1000931-04-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 633.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-hydroxy-4-phenylpiperidine-1-carboxylate (CAS 1000931-04-3) is a chemical compound with the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 3-hydroxy-4-phenylpiperidine-1-carboxylate. InChIKey: HWNKSGVMOCONJS-UHFFFAOYSA-N.
| Molecular formula | C16H23NO3 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-4-phenylpiperidine-1-carboxylate |
| InChIKey | HWNKSGVMOCONJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)