cas: 146667-87-0 — see every product listed under this CAS number, including other names
1-Boc-3-vinyl-piperidine, 97% (CAS 146667-87-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048711-100MG |
| cas | 146667-87-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 747.67 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 500mg | 1559.89 Pln | |
| Fluorochem | 1g | 2294.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-ethenylpiperidine-1-carboxylate (CAS 146667-87-0) is a chemical compound with the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. IUPAC name: tert-butyl 3-ethenylpiperidine-1-carboxylate. InChIKey: JCQBWMAWTUBARI-UHFFFAOYSA-N.
| Molecular formula | C12H21NO2 |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | tert-butyl 3-ethenylpiperidine-1-carboxylate |
| InChIKey | JCQBWMAWTUBARI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)C=C |
Computed by PubChem (NCBI)