Products 2504147-55-9

CAS 2504147-55-9 is the registry number for Trans 4-cyclobutylamino-cyclohexanecarboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(cyclobutylamino)cyclohexane-1-carboxylate (CAS 2504147-55-9) is a chemical compound with the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. IUPAC name: methyl 4-(cyclobutylamino)cyclohexane-1-carboxylate. InChIKey: RSICTUHLBFYMQF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO2
Molecular weight211.30 g/mol
IUPAC namemethyl 4-(cyclobutylamino)cyclohexane-1-carboxylate
InChIKeyRSICTUHLBFYMQF-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC(CC1)NC2CCC2

Computed by PubChem (NCBI)