Products 100453-11-0

CAS 100453-11-0 is the registry number for Ethyl 1-methylbutyl cyanoacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-cyano-2-ethyl-3-methylhexanoate (CAS 100453-11-0) is a chemical compound with the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. IUPAC name: ethyl 2-cyano-2-ethyl-3-methylhexanoate. InChIKey: FOGOQVLUCORCHH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H21NO2
Molecular weight211.30 g/mol
IUPAC nameethyl 2-cyano-2-ethyl-3-methylhexanoate
InChIKeyFOGOQVLUCORCHH-UHFFFAOYSA-N
SMILESCCCC(C)C(CC)(C#N)C(=O)OCC

Computed by PubChem (NCBI)