cas: 416852-69-2 — see every product listed under this CAS number, including other names
1-Boc-4-((N-methoxy-N-methylcarbamoyl)methyl)piperidine, ≥97-<99% (CAS 416852-69-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1547-97-99-5g |
| cas | 416852-69-2 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 5207.84 Pln | |
| Hoffman Fine Chemicals | 10g | 8155.40 Pln | |
| Hoffman Fine Chemicals | 25g | 15990.04 Pln | |
| Hoffman Fine Chemicals | 50g | 25406.92 Pln | |
| Hoffman Fine Chemicals | 100g | 42971.06 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Tert-butyl 4-[2-[methoxy(methyl)amino]-2-oxoethyl]piperidine-1-carboxylate (CAS 416852-69-2) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: tert-butyl 4-[2-[methoxy(methyl)amino]-2-oxoethyl]piperidine-1-carboxylate. InChIKey: VOUMNMSUVOACEZ-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | tert-butyl 4-[2-[methoxy(methyl)amino]-2-oxoethyl]piperidine-1-carboxylate |
| InChIKey | VOUMNMSUVOACEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CC(=O)N(C)OC |
Computed by PubChem (NCBI)